2-(2,4-dimethylanilino)-4'-methyl-2'-(morpholin-4-yl)[4,5'-bipyrimidin]-6(1H)-one
Chemical Structure Depiction of
2-(2,4-dimethylanilino)-4'-methyl-2'-(morpholin-4-yl)[4,5'-bipyrimidin]-6(1H)-one
2-(2,4-dimethylanilino)-4'-methyl-2'-(morpholin-4-yl)[4,5'-bipyrimidin]-6(1H)-one
Compound characteristics
| Compound ID: | Y020-3975 |
| Compound Name: | 2-(2,4-dimethylanilino)-4'-methyl-2'-(morpholin-4-yl)[4,5'-bipyrimidin]-6(1H)-one |
| Molecular Weight: | 392.46 |
| Molecular Formula: | C21 H24 N6 O2 |
| Smiles: | Cc1ccc(c(C)c1)NC1NC(C=C(c2cnc(nc2C)N2CCOCC2)N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5408 |
| logD: | 2.4974 |
| logSw: | -2.9066 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.846 |
| InChI Key: | KWKOTDKKCAASCT-UHFFFAOYSA-N |