N~2~-(naphthalen-2-yl)-6-{[(1-phenyl-1H-tetrazol-5-yl)sulfanyl]methyl}-1,3,5-triazine-2,4-diamine
Chemical Structure Depiction of
N~2~-(naphthalen-2-yl)-6-{[(1-phenyl-1H-tetrazol-5-yl)sulfanyl]methyl}-1,3,5-triazine-2,4-diamine
N~2~-(naphthalen-2-yl)-6-{[(1-phenyl-1H-tetrazol-5-yl)sulfanyl]methyl}-1,3,5-triazine-2,4-diamine
Compound characteristics
| Compound ID: | Y020-5926 |
| Compound Name: | N~2~-(naphthalen-2-yl)-6-{[(1-phenyl-1H-tetrazol-5-yl)sulfanyl]methyl}-1,3,5-triazine-2,4-diamine |
| Molecular Weight: | 427.49 |
| Molecular Formula: | C21 H17 N9 S |
| Smiles: | C(c1nc(N)nc(Nc2ccc3ccccc3c2)n1)Sc1nnnn1c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.5995 |
| logD: | 4.5961 |
| logSw: | -4.968 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 100.987 |
| InChI Key: | VMXVOOYSURCIKR-UHFFFAOYSA-N |