6-{[4-(4-fluorophenyl)piperazin-1-yl]methyl}-N~2~-(2-methylphenyl)-1,3,5-triazine-2,4-diamine
Chemical Structure Depiction of
6-{[4-(4-fluorophenyl)piperazin-1-yl]methyl}-N~2~-(2-methylphenyl)-1,3,5-triazine-2,4-diamine
6-{[4-(4-fluorophenyl)piperazin-1-yl]methyl}-N~2~-(2-methylphenyl)-1,3,5-triazine-2,4-diamine
Compound characteristics
| Compound ID: | Y020-6666 |
| Compound Name: | 6-{[4-(4-fluorophenyl)piperazin-1-yl]methyl}-N~2~-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| Molecular Weight: | 393.47 |
| Molecular Formula: | C21 H24 F N7 |
| Smiles: | Cc1ccccc1Nc1nc(CN2CCN(CC2)c2ccc(cc2)F)nc(N)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.3768 |
| logD: | 3.3554 |
| logSw: | -3.3873 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 67.903 |
| InChI Key: | RBYXFGNOBOXKTC-UHFFFAOYSA-N |