2-amino-N-(2-ethylphenyl)-4-oxo-5,6-dihydro-4H-1,3-thiazine-6-carboxamide
Chemical Structure Depiction of
2-amino-N-(2-ethylphenyl)-4-oxo-5,6-dihydro-4H-1,3-thiazine-6-carboxamide
2-amino-N-(2-ethylphenyl)-4-oxo-5,6-dihydro-4H-1,3-thiazine-6-carboxamide
Compound characteristics
| Compound ID: | Y020-6931 |
| Compound Name: | 2-amino-N-(2-ethylphenyl)-4-oxo-5,6-dihydro-4H-1,3-thiazine-6-carboxamide |
| Molecular Weight: | 277.34 |
| Molecular Formula: | C13 H15 N3 O2 S |
| Smiles: | CCc1ccccc1NC(C1CC(N=C(N)S1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.3416 |
| logD: | 1.3416 |
| logSw: | -2.2426 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 65.046 |
| InChI Key: | PLLAIXQURJPLMC-JTQLQIEISA-N |