N-{5-[(2-fluorophenyl)methyl]-1,4,5,6-tetrahydro-1,3,5-triazin-2-yl}methanesulfonamide
Chemical Structure Depiction of
N-{5-[(2-fluorophenyl)methyl]-1,4,5,6-tetrahydro-1,3,5-triazin-2-yl}methanesulfonamide
N-{5-[(2-fluorophenyl)methyl]-1,4,5,6-tetrahydro-1,3,5-triazin-2-yl}methanesulfonamide
Compound characteristics
| Compound ID: | Y020-8498 |
| Compound Name: | N-{5-[(2-fluorophenyl)methyl]-1,4,5,6-tetrahydro-1,3,5-triazin-2-yl}methanesulfonamide |
| Molecular Weight: | 286.33 |
| Molecular Formula: | C11 H15 F N4 O2 S |
| Smiles: | CS(NC1NCN(Cc2ccccc2F)CN=1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.9905 |
| logD: | 0.9905 |
| logSw: | -2.2395 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.999 |
| InChI Key: | XNRRDEYOMINCJL-UHFFFAOYSA-N |