2-(furan-2-yl)-7-phenyl[1,2,4]triazolo[1,5-a]pyrimidine
Chemical Structure Depiction of
2-(furan-2-yl)-7-phenyl[1,2,4]triazolo[1,5-a]pyrimidine
2-(furan-2-yl)-7-phenyl[1,2,4]triazolo[1,5-a]pyrimidine
Compound characteristics
| Compound ID: | Y020-9490 |
| Compound Name: | 2-(furan-2-yl)-7-phenyl[1,2,4]triazolo[1,5-a]pyrimidine |
| Molecular Weight: | 262.27 |
| Molecular Formula: | C15 H10 N4 O |
| Smiles: | c1ccc(cc1)c1ccnc2nc(c3ccco3)nn12 |
| Stereo: | ACHIRAL |
| logP: | 2.7151 |
| logD: | 2.7151 |
| logSw: | -2.8155 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.52 |
| InChI Key: | RLGPHQGIYIFVFG-UHFFFAOYSA-N |