N-(6-chloro-1,3-benzothiazol-2-yl)guanidine
Chemical Structure Depiction of
N-(6-chloro-1,3-benzothiazol-2-yl)guanidine
N-(6-chloro-1,3-benzothiazol-2-yl)guanidine
Compound characteristics
| Compound ID: | Y021-3149 |
| Compound Name: | N-(6-chloro-1,3-benzothiazol-2-yl)guanidine |
| Molecular Weight: | 226.68 |
| Molecular Formula: | C8 H7 Cl N4 S |
| Smiles: | c1cc2c(cc1[Cl])sc(NC(N)=N)n2 |
| Stereo: | ACHIRAL |
| logP: | 2.3312 |
| logD: | -4.5914 |
| logSw: | -3.0875 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 58.837 |
| InChI Key: | ZXLLIQSDONCKRA-UHFFFAOYSA-N |