N-(6-methylpyridin-2-yl)benzenesulfonamide
Chemical Structure Depiction of
N-(6-methylpyridin-2-yl)benzenesulfonamide
N-(6-methylpyridin-2-yl)benzenesulfonamide
Compound characteristics
| Compound ID: | Y030-0033 |
| Compound Name: | N-(6-methylpyridin-2-yl)benzenesulfonamide |
| Molecular Weight: | 248.3 |
| Molecular Formula: | C12 H12 N2 O2 S |
| Smiles: | Cc1cccc(NS(c2ccccc2)(=O)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.2227 |
| logD: | 1.7354 |
| logSw: | -2.6938 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.877 |
| InChI Key: | DKRBJCJLHMNGJG-UHFFFAOYSA-N |