2-bromo-N,N-dibutylbenzamide
Chemical Structure Depiction of
2-bromo-N,N-dibutylbenzamide
2-bromo-N,N-dibutylbenzamide
Compound characteristics
| Compound ID: | Y030-0385 |
| Compound Name: | 2-bromo-N,N-dibutylbenzamide |
| Molecular Weight: | 312.25 |
| Molecular Formula: | C15 H22 Br N O |
| Smiles: | CCCCN(CCCC)C(c1ccccc1[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.4115 |
| logD: | 4.4115 |
| logSw: | -4.2053 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 16.6778 |
| InChI Key: | MSUBAUQKUIUIOU-UHFFFAOYSA-N |