N~1~,N~3~-bis(2,4-dichlorophenyl)benzene-1,3-dicarboxamide
Chemical Structure Depiction of
N~1~,N~3~-bis(2,4-dichlorophenyl)benzene-1,3-dicarboxamide
N~1~,N~3~-bis(2,4-dichlorophenyl)benzene-1,3-dicarboxamide
Compound characteristics
| Compound ID: | Y030-0593 |
| Compound Name: | N~1~,N~3~-bis(2,4-dichlorophenyl)benzene-1,3-dicarboxamide |
| Molecular Weight: | 454.14 |
| Molecular Formula: | C20 H12 Cl4 N2 O2 |
| Smiles: | c1cc(cc(c1)C(Nc1ccc(cc1[Cl])[Cl])=O)C(Nc1ccc(cc1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.1929 |
| logD: | 5.3358 |
| logSw: | -6.424 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 45.025 |
| InChI Key: | ZONILYUDXWXKHJ-UHFFFAOYSA-N |