N-cycloheptyl-4-fluorobenzene-1-sulfonamide
Chemical Structure Depiction of
N-cycloheptyl-4-fluorobenzene-1-sulfonamide
N-cycloheptyl-4-fluorobenzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y030-0828 |
| Compound Name: | N-cycloheptyl-4-fluorobenzene-1-sulfonamide |
| Molecular Weight: | 271.35 |
| Molecular Formula: | C13 H18 F N O2 S |
| Smiles: | C1CCCC(CC1)NS(c1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8098 |
| logD: | 3.8098 |
| logSw: | -3.984 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.266 |
| InChI Key: | QWTHGLGLXJYNQU-UHFFFAOYSA-N |