(3,4-dihydroquinolin-1(2H)-yl)(thiophen-2-yl)methanone
Chemical Structure Depiction of
(3,4-dihydroquinolin-1(2H)-yl)(thiophen-2-yl)methanone
(3,4-dihydroquinolin-1(2H)-yl)(thiophen-2-yl)methanone
Compound characteristics
| Compound ID: | Y030-1044 |
| Compound Name: | (3,4-dihydroquinolin-1(2H)-yl)(thiophen-2-yl)methanone |
| Molecular Weight: | 243.32 |
| Molecular Formula: | C14 H13 N O S |
| Smiles: | C1Cc2ccccc2N(C1)C(c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5054 |
| logD: | 3.5054 |
| logSw: | -3.6419 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 16.5696 |
| InChI Key: | IVOXWMYBGUNLJR-UHFFFAOYSA-N |