2-fluoro-N-(2-phenylethyl)benzamide
Chemical Structure Depiction of
2-fluoro-N-(2-phenylethyl)benzamide
2-fluoro-N-(2-phenylethyl)benzamide
Compound characteristics
| Compound ID: | Y030-1372 |
| Compound Name: | 2-fluoro-N-(2-phenylethyl)benzamide |
| Molecular Weight: | 243.28 |
| Molecular Formula: | C15 H14 F N O |
| Smiles: | C(CNC(c1ccccc1F)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 2.901 |
| logD: | 2.901 |
| logSw: | -3.6325 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.4932 |
| InChI Key: | NKLQTEVEGVFUQY-UHFFFAOYSA-N |