N-(3-chlorophenyl)-2-methylpropanamide
Chemical Structure Depiction of
N-(3-chlorophenyl)-2-methylpropanamide
N-(3-chlorophenyl)-2-methylpropanamide
Compound characteristics
| Compound ID: | Y030-1456 |
| Compound Name: | N-(3-chlorophenyl)-2-methylpropanamide |
| Molecular Weight: | 197.66 |
| Molecular Formula: | C10 H12 Cl N O |
| Smiles: | CC(C)C(Nc1cccc(c1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.1147 |
| logD: | 3.1144 |
| logSw: | -3.3124 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.6011 |
| InChI Key: | XJJWNMFVLXRGNJ-UHFFFAOYSA-N |