4-(benzylcarbamoyl)phenyl acetate
Chemical Structure Depiction of
4-(benzylcarbamoyl)phenyl acetate
4-(benzylcarbamoyl)phenyl acetate
Compound characteristics
| Compound ID: | Y030-2485 |
| Compound Name: | 4-(benzylcarbamoyl)phenyl acetate |
| Molecular Weight: | 269.3 |
| Molecular Formula: | C16 H15 N O3 |
| Smiles: | CC(=O)Oc1ccc(cc1)C(NCc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.166 |
| logD: | 2.166 |
| logSw: | -2.5309 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.403 |
| InChI Key: | KFLAYIIXIQDSPI-UHFFFAOYSA-N |