1-(4-benzylpiperidin-1-yl)ethan-1-one
Chemical Structure Depiction of
1-(4-benzylpiperidin-1-yl)ethan-1-one
1-(4-benzylpiperidin-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | Y030-2601 |
| Compound Name: | 1-(4-benzylpiperidin-1-yl)ethan-1-one |
| Molecular Weight: | 217.31 |
| Molecular Formula: | C14 H19 N O |
| Smiles: | CC(N1CCC(CC1)Cc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9237 |
| logD: | 2.9237 |
| logSw: | -3.0479 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 17.3546 |
| InChI Key: | BKQOKWBHIBQLIH-UHFFFAOYSA-N |