(2,5-dichlorophenyl)(4-methylpiperazin-1-yl)methanone
Chemical Structure Depiction of
(2,5-dichlorophenyl)(4-methylpiperazin-1-yl)methanone
(2,5-dichlorophenyl)(4-methylpiperazin-1-yl)methanone
Compound characteristics
| Compound ID: | Y030-2717 |
| Compound Name: | (2,5-dichlorophenyl)(4-methylpiperazin-1-yl)methanone |
| Molecular Weight: | 273.16 |
| Molecular Formula: | C12 H14 Cl2 N2 O |
| Smiles: | CN1CCN(CC1)C(c1cc(ccc1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 2.276 |
| logD: | 2.1453 |
| logSw: | -3.3717 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 20.3633 |
| InChI Key: | WZSRXRVGJUPXSY-UHFFFAOYSA-N |