N-(4-bromo-2-fluorophenyl)-2,5-dichlorobenzamide
Chemical Structure Depiction of
N-(4-bromo-2-fluorophenyl)-2,5-dichlorobenzamide
N-(4-bromo-2-fluorophenyl)-2,5-dichlorobenzamide
Compound characteristics
| Compound ID: | Y030-2723 |
| Compound Name: | N-(4-bromo-2-fluorophenyl)-2,5-dichlorobenzamide |
| Molecular Weight: | 363.01 |
| Molecular Formula: | C13 H7 Br Cl2 F N O |
| Smiles: | c1cc(c(cc1[Cl])C(Nc1ccc(cc1F)[Br])=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.133 |
| logD: | 3.4149 |
| logSw: | -5.6313 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.6318 |
| InChI Key: | QBKIKQNFSYWCDJ-UHFFFAOYSA-N |