ethyl (2,5-dimethylanilino)(oxo)acetate
Chemical Structure Depiction of
ethyl (2,5-dimethylanilino)(oxo)acetate
ethyl (2,5-dimethylanilino)(oxo)acetate
Compound characteristics
| Compound ID: | Y030-3354 |
| Compound Name: | ethyl (2,5-dimethylanilino)(oxo)acetate |
| Molecular Weight: | 221.25 |
| Molecular Formula: | C12 H15 N O3 |
| Smiles: | CCOC(C(Nc1cc(C)ccc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0314 |
| logD: | 2.017 |
| logSw: | -2.5813 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.657 |
| InChI Key: | VSSSSXRVTDMNBM-UHFFFAOYSA-N |