N-(2,4-difluorophenyl)-2-ethylhexanamide
Chemical Structure Depiction of
N-(2,4-difluorophenyl)-2-ethylhexanamide
N-(2,4-difluorophenyl)-2-ethylhexanamide
Compound characteristics
| Compound ID: | Y030-3407 |
| Compound Name: | N-(2,4-difluorophenyl)-2-ethylhexanamide |
| Molecular Weight: | 255.31 |
| Molecular Formula: | C14 H19 F2 N O |
| Smiles: | CCCCC(CC)C(Nc1ccc(cc1F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2966 |
| logD: | 4.2546 |
| logSw: | -4.2266 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.9033 |
| InChI Key: | LWRBLKULJJMQFL-JTQLQIEISA-N |