4-(dimethylamino)-N-[4-(dimethylamino)phenyl]benzamide
Chemical Structure Depiction of
4-(dimethylamino)-N-[4-(dimethylamino)phenyl]benzamide
4-(dimethylamino)-N-[4-(dimethylamino)phenyl]benzamide
Compound characteristics
| Compound ID: | Y030-3634 |
| Compound Name: | 4-(dimethylamino)-N-[4-(dimethylamino)phenyl]benzamide |
| Molecular Weight: | 283.37 |
| Molecular Formula: | C17 H21 N3 O |
| Smiles: | CN(C)c1ccc(cc1)C(Nc1ccc(cc1)N(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2009 |
| logD: | 3.1922 |
| logSw: | -3.6614 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.9391 |
| InChI Key: | QEHZRNVOTHGKIX-UHFFFAOYSA-N |