N-(2-carbamoylphenyl)-2-fluorobenzamide
Chemical Structure Depiction of
N-(2-carbamoylphenyl)-2-fluorobenzamide
N-(2-carbamoylphenyl)-2-fluorobenzamide
Compound characteristics
| Compound ID: | Y030-3672 |
| Compound Name: | N-(2-carbamoylphenyl)-2-fluorobenzamide |
| Molecular Weight: | 258.25 |
| Molecular Formula: | C14 H11 F N2 O2 |
| Smiles: | c1ccc(c(c1)C(N)=O)NC(c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 1.7894 |
| logD: | 1.7511 |
| logSw: | -2.462 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 56.691 |
| InChI Key: | ODODUFCDFDQOGF-UHFFFAOYSA-N |