2-(2-methoxyphenyl)-N-(2,4,6-trimethylphenyl)acetamide
Chemical Structure Depiction of
2-(2-methoxyphenyl)-N-(2,4,6-trimethylphenyl)acetamide
2-(2-methoxyphenyl)-N-(2,4,6-trimethylphenyl)acetamide
Compound characteristics
| Compound ID: | Y030-3823 |
| Compound Name: | 2-(2-methoxyphenyl)-N-(2,4,6-trimethylphenyl)acetamide |
| Molecular Weight: | 283.37 |
| Molecular Formula: | C18 H21 N O2 |
| Smiles: | Cc1cc(C)c(c(C)c1)NC(Cc1ccccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6849 |
| logD: | 3.6849 |
| logSw: | -3.873 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.351 |
| InChI Key: | PQETWIZXQIGLJL-UHFFFAOYSA-N |