4-chloro-N-(3-methylbutyl)benzamide
Chemical Structure Depiction of
4-chloro-N-(3-methylbutyl)benzamide
4-chloro-N-(3-methylbutyl)benzamide
Compound characteristics
| Compound ID: | Y030-3830 |
| Compound Name: | 4-chloro-N-(3-methylbutyl)benzamide |
| Molecular Weight: | 225.72 |
| Molecular Formula: | C12 H16 Cl N O |
| Smiles: | CC(C)CCNC(c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.308 |
| logD: | 3.3079 |
| logSw: | -3.7749 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.7648 |
| InChI Key: | OOOBYIKRPVNICF-UHFFFAOYSA-N |