N-(2-methoxy-4-methylphenyl)-2,2-dimethylbutanamide
Chemical Structure Depiction of
N-(2-methoxy-4-methylphenyl)-2,2-dimethylbutanamide
N-(2-methoxy-4-methylphenyl)-2,2-dimethylbutanamide
Compound characteristics
| Compound ID: | Y030-3866 |
| Compound Name: | N-(2-methoxy-4-methylphenyl)-2,2-dimethylbutanamide |
| Molecular Weight: | 235.32 |
| Molecular Formula: | C14 H21 N O2 |
| Smiles: | CCC(C)(C)C(Nc1ccc(C)cc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9608 |
| logD: | 3.9604 |
| logSw: | -3.9414 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.5338 |
| InChI Key: | GCDMFEMTAMVKSW-UHFFFAOYSA-N |