N'-(2,3-dimethylphenyl)-N,N-dimethylsulfuric diamide
Chemical Structure Depiction of
N'-(2,3-dimethylphenyl)-N,N-dimethylsulfuric diamide
N'-(2,3-dimethylphenyl)-N,N-dimethylsulfuric diamide
Compound characteristics
| Compound ID: | Y030-4056 |
| Compound Name: | N'-(2,3-dimethylphenyl)-N,N-dimethylsulfuric diamide |
| Molecular Weight: | 228.31 |
| Molecular Formula: | C10 H16 N2 O2 S |
| Smiles: | Cc1cccc(c1C)NS(N(C)C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3879 |
| logD: | 2.3879 |
| logSw: | -2.7188 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.882 |
| InChI Key: | VHALTYJRTCSZRE-UHFFFAOYSA-N |