4-(4-fluorophenyl)-N,N-dimethylpiperazine-1-sulfonamide
Chemical Structure Depiction of
4-(4-fluorophenyl)-N,N-dimethylpiperazine-1-sulfonamide
4-(4-fluorophenyl)-N,N-dimethylpiperazine-1-sulfonamide
Compound characteristics
| Compound ID: | Y030-4103 |
| Compound Name: | 4-(4-fluorophenyl)-N,N-dimethylpiperazine-1-sulfonamide |
| Molecular Weight: | 287.35 |
| Molecular Formula: | C12 H18 F N3 O2 S |
| Smiles: | CN(C)S(N1CCN(CC1)c1ccc(cc1)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.3937 |
| logD: | 1.3937 |
| logSw: | -2.1906 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 39.568 |
| InChI Key: | NRSARHLFSWDPBE-UHFFFAOYSA-N |