N,N-diethyl-2-phenyl-2-(phenylsulfanyl)acetamide
Chemical Structure Depiction of
N,N-diethyl-2-phenyl-2-(phenylsulfanyl)acetamide
N,N-diethyl-2-phenyl-2-(phenylsulfanyl)acetamide
Compound characteristics
| Compound ID: | Y030-4233 |
| Compound Name: | N,N-diethyl-2-phenyl-2-(phenylsulfanyl)acetamide |
| Molecular Weight: | 299.43 |
| Molecular Formula: | C18 H21 N O S |
| Smiles: | CCN(CC)C(C(c1ccccc1)Sc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3714 |
| logD: | 4.3714 |
| logSw: | -4.2153 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 15.8989 |
| InChI Key: | GEKIPMNICULUKY-QGZVFWFLSA-N |