N-(2-benzoyl-4-chlorophenyl)-2-methoxy-4-(methylsulfanyl)benzamide
Chemical Structure Depiction of
N-(2-benzoyl-4-chlorophenyl)-2-methoxy-4-(methylsulfanyl)benzamide
N-(2-benzoyl-4-chlorophenyl)-2-methoxy-4-(methylsulfanyl)benzamide
Compound characteristics
| Compound ID: | Y030-4459 |
| Compound Name: | N-(2-benzoyl-4-chlorophenyl)-2-methoxy-4-(methylsulfanyl)benzamide |
| Molecular Weight: | 411.91 |
| Molecular Formula: | C22 H18 Cl N O3 S |
| Smiles: | COc1cc(ccc1C(Nc1ccc(cc1C(c1ccccc1)=O)[Cl])=O)SC |
| Stereo: | ACHIRAL |
| logP: | 5.4351 |
| logD: | 4.6032 |
| logSw: | -5.9848 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.729 |
| InChI Key: | OCNMEHXUHIFFNX-UHFFFAOYSA-N |