ethyl (2-bromoanilino)(oxo)acetate
Chemical Structure Depiction of
ethyl (2-bromoanilino)(oxo)acetate
ethyl (2-bromoanilino)(oxo)acetate
Compound characteristics
| Compound ID: | Y030-5496 |
| Compound Name: | ethyl (2-bromoanilino)(oxo)acetate |
| Molecular Weight: | 272.1 |
| Molecular Formula: | C10 H10 Br N O3 |
| Smiles: | CCOC(C(Nc1ccccc1[Br])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.253 |
| logD: | 2.1461 |
| logSw: | -2.7409 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.657 |
| InChI Key: | FZDVRUSWCKVFDK-UHFFFAOYSA-N |