3-[(4-chlorobenzene-1-sulfonyl)amino]-N,N-diethyl-4-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
3-[(4-chlorobenzene-1-sulfonyl)amino]-N,N-diethyl-4-methoxybenzene-1-sulfonamide
3-[(4-chlorobenzene-1-sulfonyl)amino]-N,N-diethyl-4-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | Y030-5741 |
| Compound Name: | 3-[(4-chlorobenzene-1-sulfonyl)amino]-N,N-diethyl-4-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 432.94 |
| Molecular Formula: | C17 H21 Cl N2 O5 S2 |
| Smiles: | CCN(CC)S(c1ccc(c(c1)NS(c1ccc(cc1)[Cl])(=O)=O)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3511 |
| logD: | 1.0383 |
| logSw: | -3.7728 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.917 |
| InChI Key: | ZQLCOZWULRSUGR-UHFFFAOYSA-N |