N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2H-1,3-benzodioxole-5-carboxamide
Chemical Structure Depiction of
N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2H-1,3-benzodioxole-5-carboxamide
N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2H-1,3-benzodioxole-5-carboxamide
Compound characteristics
| Compound ID: | Y030-6043 |
| Compound Name: | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2H-1,3-benzodioxole-5-carboxamide |
| Molecular Weight: | 406.46 |
| Molecular Formula: | C19 H22 N2 O6 S |
| Smiles: | CCN(CC)S(c1ccc(c(c1)NC(c1ccc2c(c1)OCO2)=O)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7938 |
| logD: | 2.7777 |
| logSw: | -3.5282 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.474 |
| InChI Key: | XYNYUZDJIUXTAT-UHFFFAOYSA-N |