N-[2-(4-fluorophenyl)ethyl]morpholine-4-carboxamide
Chemical Structure Depiction of
N-[2-(4-fluorophenyl)ethyl]morpholine-4-carboxamide
N-[2-(4-fluorophenyl)ethyl]morpholine-4-carboxamide
Compound characteristics
| Compound ID: | Y030-6079 |
| Compound Name: | N-[2-(4-fluorophenyl)ethyl]morpholine-4-carboxamide |
| Molecular Weight: | 252.29 |
| Molecular Formula: | C13 H17 F N2 O2 |
| Smiles: | C(CNC(N1CCOCC1)=O)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 1.3767 |
| logD: | 1.3767 |
| logSw: | -1.9252 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.78 |
| InChI Key: | ZFOCWCXCMCCWFD-UHFFFAOYSA-N |