2-(4-fluorophenyl)-N-(2-oxothiolan-3-yl)acetamide
Chemical Structure Depiction of
2-(4-fluorophenyl)-N-(2-oxothiolan-3-yl)acetamide
2-(4-fluorophenyl)-N-(2-oxothiolan-3-yl)acetamide
Compound characteristics
| Compound ID: | Y030-6541 |
| Compound Name: | 2-(4-fluorophenyl)-N-(2-oxothiolan-3-yl)acetamide |
| Molecular Weight: | 253.29 |
| Molecular Formula: | C12 H12 F N O2 S |
| Smiles: | C1CSC(C1NC(Cc1ccc(cc1)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.2105 |
| logD: | 1.1679 |
| logSw: | -1.983 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.992 |
| InChI Key: | FVBFSDFMOWPXTK-SNVBAGLBSA-N |