N-(4-iodophenyl)-3-phenylbutanamide
Chemical Structure Depiction of
N-(4-iodophenyl)-3-phenylbutanamide
N-(4-iodophenyl)-3-phenylbutanamide
Compound characteristics
| Compound ID: | Y030-6606 |
| Compound Name: | N-(4-iodophenyl)-3-phenylbutanamide |
| Molecular Weight: | 365.21 |
| Molecular Formula: | C16 H16 I N O |
| Smiles: | CC(CC(Nc1ccc(cc1)I)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3485 |
| logD: | 5.3477 |
| logSw: | -5.3989 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.1162 |
| InChI Key: | AGJPJHWGLHYCPA-LBPRGKRZSA-N |