1-(morpholin-4-yl)-4-phenoxybutan-1-one
Chemical Structure Depiction of
1-(morpholin-4-yl)-4-phenoxybutan-1-one
1-(morpholin-4-yl)-4-phenoxybutan-1-one
Compound characteristics
| Compound ID: | Y030-6710 |
| Compound Name: | 1-(morpholin-4-yl)-4-phenoxybutan-1-one |
| Molecular Weight: | 249.31 |
| Molecular Formula: | C14 H19 N O3 |
| Smiles: | C(CC(N1CCOCC1)=O)COc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 1.5106 |
| logD: | 1.5106 |
| logSw: | -1.5309 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.686 |
| InChI Key: | XRFCKPUSDCCKCS-UHFFFAOYSA-N |