2-(4-chlorophenoxy)-1-(2-ethylpiperidin-1-yl)-2-methylpropan-1-one
Chemical Structure Depiction of
2-(4-chlorophenoxy)-1-(2-ethylpiperidin-1-yl)-2-methylpropan-1-one
2-(4-chlorophenoxy)-1-(2-ethylpiperidin-1-yl)-2-methylpropan-1-one
Compound characteristics
| Compound ID: | Y030-7621 |
| Compound Name: | 2-(4-chlorophenoxy)-1-(2-ethylpiperidin-1-yl)-2-methylpropan-1-one |
| Molecular Weight: | 309.83 |
| Molecular Formula: | C17 H24 Cl N O2 |
| Smiles: | CCC1CCCCN1C(C(C)(C)Oc1ccc(cc1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3195 |
| logD: | 4.3195 |
| logSw: | -4.5837 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 22.7525 |
| InChI Key: | CNFUMFHSMAYSHB-AWEZNQCLSA-N |