N-(4-bromo-2-methylphenyl)-2-ethylbutanamide
Chemical Structure Depiction of
N-(4-bromo-2-methylphenyl)-2-ethylbutanamide
N-(4-bromo-2-methylphenyl)-2-ethylbutanamide
Compound characteristics
| Compound ID: | Y030-7905 |
| Compound Name: | N-(4-bromo-2-methylphenyl)-2-ethylbutanamide |
| Molecular Weight: | 284.19 |
| Molecular Formula: | C13 H18 Br N O |
| Smiles: | CCC(CC)C(Nc1ccc(cc1C)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.1261 |
| logD: | 4.1251 |
| logSw: | -4.1024 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.9033 |
| InChI Key: | YBWIKUPUQCVRQS-UHFFFAOYSA-N |