2-ethoxy-N-{4-[(2-phenylethyl)sulfamoyl]phenyl}benzamide
Chemical Structure Depiction of
2-ethoxy-N-{4-[(2-phenylethyl)sulfamoyl]phenyl}benzamide
2-ethoxy-N-{4-[(2-phenylethyl)sulfamoyl]phenyl}benzamide
Compound characteristics
| Compound ID: | Y030-8377 |
| Compound Name: | 2-ethoxy-N-{4-[(2-phenylethyl)sulfamoyl]phenyl}benzamide |
| Molecular Weight: | 424.52 |
| Molecular Formula: | C23 H24 N2 O4 S |
| Smiles: | CCOc1ccccc1C(Nc1ccc(cc1)S(NCCc1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.17 |
| logD: | 3.91 |
| logSw: | -4.2795 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.14 |
| InChI Key: | FXAGELXMLXJQFO-UHFFFAOYSA-N |