N-(4-phenylbutan-2-yl)oxolane-2-carboxamide
Chemical Structure Depiction of
N-(4-phenylbutan-2-yl)oxolane-2-carboxamide
N-(4-phenylbutan-2-yl)oxolane-2-carboxamide
Compound characteristics
| Compound ID: | Y030-8661 |
| Compound Name: | N-(4-phenylbutan-2-yl)oxolane-2-carboxamide |
| Molecular Weight: | 247.34 |
| Molecular Formula: | C15 H21 N O2 |
| Smiles: | CC(CCc1ccccc1)NC(C1CCCO1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.3675 |
| logD: | 2.3675 |
| logSw: | -2.6087 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.505 |
| InChI Key: | VWFLYEWALAAOCG-UHFFFAOYSA-N |