2-(phenylmethanesulfonyl)-N-(pyridin-2-yl)acetamide
Chemical Structure Depiction of
2-(phenylmethanesulfonyl)-N-(pyridin-2-yl)acetamide
2-(phenylmethanesulfonyl)-N-(pyridin-2-yl)acetamide
Compound characteristics
| Compound ID: | Y030-9188 |
| Compound Name: | 2-(phenylmethanesulfonyl)-N-(pyridin-2-yl)acetamide |
| Molecular Weight: | 290.34 |
| Molecular Formula: | C14 H14 N2 O3 S |
| Smiles: | C(C(Nc1ccccn1)=O)S(Cc1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.2364 |
| logD: | 1.235 |
| logSw: | -2.2393 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.031 |
| InChI Key: | DONKFSQFIKVEAU-UHFFFAOYSA-N |