N-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-2-(phenylmethanesulfonyl)acetamide
Chemical Structure Depiction of
N-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-2-(phenylmethanesulfonyl)acetamide
N-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-2-(phenylmethanesulfonyl)acetamide
Compound characteristics
| Compound ID: | Y030-9229 |
| Compound Name: | N-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-2-(phenylmethanesulfonyl)acetamide |
| Molecular Weight: | 400.52 |
| Molecular Formula: | C20 H20 N2 O3 S2 |
| Smiles: | CCc1c(c2ccccc2)nc(NC(CS(Cc2ccccc2)(=O)=O)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.7233 |
| logD: | 3.7216 |
| logSw: | -3.9361 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.962 |
| InChI Key: | MGJRDJPRYLHPHS-UHFFFAOYSA-N |