1-(4-benzylpiperazin-1-yl)butan-1-one
Chemical Structure Depiction of
1-(4-benzylpiperazin-1-yl)butan-1-one
1-(4-benzylpiperazin-1-yl)butan-1-one
Compound characteristics
| Compound ID: | Y030-9315 |
| Compound Name: | 1-(4-benzylpiperazin-1-yl)butan-1-one |
| Molecular Weight: | 246.35 |
| Molecular Formula: | C15 H22 N2 O |
| Smiles: | CCCC(N1CCN(CC1)Cc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1298 |
| logD: | 2.0969 |
| logSw: | -2.2546 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 20.1713 |
| InChI Key: | DQXACBJQQWXRHG-UHFFFAOYSA-N |