N-(4-butylphenyl)-2-[(4-methylphenyl)sulfanyl]acetamide
Chemical Structure Depiction of
N-(4-butylphenyl)-2-[(4-methylphenyl)sulfanyl]acetamide
N-(4-butylphenyl)-2-[(4-methylphenyl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | Y030-9331 |
| Compound Name: | N-(4-butylphenyl)-2-[(4-methylphenyl)sulfanyl]acetamide |
| Molecular Weight: | 313.46 |
| Molecular Formula: | C19 H23 N O S |
| Smiles: | CCCCc1ccc(cc1)NC(CSc1ccc(C)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8997 |
| logD: | 5.8997 |
| logSw: | -5.3517 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.1162 |
| InChI Key: | GCAPFQYGOWXSLA-UHFFFAOYSA-N |