N-(2-methylbutan-2-yl)-4-phenoxybutanamide
Chemical Structure Depiction of
N-(2-methylbutan-2-yl)-4-phenoxybutanamide
N-(2-methylbutan-2-yl)-4-phenoxybutanamide
Compound characteristics
| Compound ID: | Y030-9550 |
| Compound Name: | N-(2-methylbutan-2-yl)-4-phenoxybutanamide |
| Molecular Weight: | 249.35 |
| Molecular Formula: | C15 H23 N O2 |
| Smiles: | CCC(C)(C)NC(CCCOc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8567 |
| logD: | 2.8566 |
| logSw: | -3.1474 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.4186 |
| InChI Key: | HDCKUJRDEXNYDZ-UHFFFAOYSA-N |