N,N-bis(2-cyanoethyl)-2-(2,4-dichlorophenoxy)acetamide
Chemical Structure Depiction of
N,N-bis(2-cyanoethyl)-2-(2,4-dichlorophenoxy)acetamide
N,N-bis(2-cyanoethyl)-2-(2,4-dichlorophenoxy)acetamide
Compound characteristics
| Compound ID: | Y030-9714 |
| Compound Name: | N,N-bis(2-cyanoethyl)-2-(2,4-dichlorophenoxy)acetamide |
| Molecular Weight: | 326.18 |
| Molecular Formula: | C14 H13 Cl2 N3 O2 |
| Smiles: | C(CN(CCC#N)C(COc1ccc(cc1[Cl])[Cl])=O)C#N |
| Stereo: | ACHIRAL |
| logP: | 1.1357 |
| logD: | 1.1357 |
| logSw: | -2.6302 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 58.72 |
| InChI Key: | CUTVKDDDUJIWHK-UHFFFAOYSA-N |