N-{4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]phenyl}pentanamide
Chemical Structure Depiction of
N-{4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]phenyl}pentanamide
N-{4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]phenyl}pentanamide
Compound characteristics
| Compound ID: | Y030-9836 |
| Compound Name: | N-{4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]phenyl}pentanamide |
| Molecular Weight: | 393.53 |
| Molecular Formula: | C24 H31 N3 O2 |
| Smiles: | CCCCC(Nc1ccc(cc1)C(N1CCN(CC1)c1cccc(C)c1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3804 |
| logD: | 4.3799 |
| logSw: | -4.0766 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.995 |
| InChI Key: | YQLPXQWCXDVGCJ-UHFFFAOYSA-N |