N-[4-(cyclohexylsulfamoyl)phenyl]-2-phenoxybenzamide
Chemical Structure Depiction of
N-[4-(cyclohexylsulfamoyl)phenyl]-2-phenoxybenzamide
N-[4-(cyclohexylsulfamoyl)phenyl]-2-phenoxybenzamide
Compound characteristics
| Compound ID: | Y031-0845 |
| Compound Name: | N-[4-(cyclohexylsulfamoyl)phenyl]-2-phenoxybenzamide |
| Molecular Weight: | 450.56 |
| Molecular Formula: | C25 H26 N2 O4 S |
| Smiles: | C1CCC(CC1)NS(c1ccc(cc1)NC(c1ccccc1Oc1ccccc1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5831 |
| logD: | 5.5512 |
| logSw: | -5.7416 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.861 |
| InChI Key: | FRTRFTGDWKBBON-UHFFFAOYSA-N |