N-benzyl-1-(4-chlorophenyl)-N-(propan-2-yl)methanesulfonamide
Chemical Structure Depiction of
N-benzyl-1-(4-chlorophenyl)-N-(propan-2-yl)methanesulfonamide
N-benzyl-1-(4-chlorophenyl)-N-(propan-2-yl)methanesulfonamide
Compound characteristics
| Compound ID: | Y031-1135 |
| Compound Name: | N-benzyl-1-(4-chlorophenyl)-N-(propan-2-yl)methanesulfonamide |
| Molecular Weight: | 337.87 |
| Molecular Formula: | C17 H20 Cl N O2 S |
| Smiles: | CC(C)N(Cc1ccccc1)S(Cc1ccc(cc1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0876 |
| logD: | 4.0876 |
| logSw: | -4.4666 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.29 |
| InChI Key: | RDUFTEHFBAOJIP-UHFFFAOYSA-N |