1-(3-methylpiperidin-1-yl)-3-(phenylmethanesulfonyl)propan-1-one
Chemical Structure Depiction of
1-(3-methylpiperidin-1-yl)-3-(phenylmethanesulfonyl)propan-1-one
1-(3-methylpiperidin-1-yl)-3-(phenylmethanesulfonyl)propan-1-one
Compound characteristics
| Compound ID: | Y031-1220 |
| Compound Name: | 1-(3-methylpiperidin-1-yl)-3-(phenylmethanesulfonyl)propan-1-one |
| Molecular Weight: | 309.43 |
| Molecular Formula: | C16 H23 N O3 S |
| Smiles: | CC1CCCN(C1)C(CCS(Cc1ccccc1)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.4021 |
| logD: | 1.4021 |
| logSw: | -2.0206 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.593 |
| InChI Key: | NDMBVDABJIJNFM-AWEZNQCLSA-N |